| Name | Benazepril HCL |
| Synonyms | Lotensin cgs14824a Benazepril HCL CGS 14824A HCl benazepril hydrochloride BenazeprilHclC24H28N205.HC1 monohydrochloride,(s-(r*,r*))-nylpropyl)amino)-2-oxo 1h-1-benzazepine-1-aceticacid,2,3,4,5-tetrahydro-3-((1-(ethoxycarbonyl)-3-phe [(3S)-3-{[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]amino}-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]acetic acid hydrochloride 1H-1-Benzazepine-1-acetic acid, 3-(1S)-1-(ethoxycarbonyl)-3-phenylpropylamino-2,3,4,5-tetrahydro-2-oxo-, monohydrochloride, (3S)- 1H-1-Benzazepine-1-acetic acid, 3-[[1-(ethoxycarbonyl)-3-phenylpropyl]amino]-2,3,4,5-tetrahydro-2-oxo-, monohydrochloride, [S-(R*,R*)]- |
| CAS | 86541-74-4 |
| EINECS | 630-414-2 |
| InChI | InChI=1/C24H28N2O5.ClH/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28;/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28);1H/t19-,20+;/m1./s1 |
| InChIKey | VPSRQEHTHIMDQM-FKLPMGAJSA-N |
| Molecular Formula | C24H29ClN2O5 |
| Molar Mass | 460.95 |
| Melting Point | 188-190°C |
| Boling Point | 215℃-220℃ |
| Specific Rotation(α) | D -141.0° (c = 0.9 in ethanol) |
| Solubility | Soluble in water (50 mM), DMSO (100 mM), ethanol, and methanol. |
| Appearance | solid |
| Color | white |
| Merck | 14,1031 |
| Storage Condition | 2-8°C |
| MDL | MFCD00895734 |
| Physical and Chemical Properties | Is an angiotensin converting enzyme inhibitor. After hydrolysis of the formation of active benazepril, inhibition of blood Nervousness hormone converting enzyme, reduce vascular Nervousness hormone II mediated by a variety of effects. The peripheral vascular resistance is reduced, lowering blood pressure, but does not cause compensatory fluid retention, can also reduce ventricular afterload, does not increase heart rate. Can improve left ventricular hypertrophy, improve diabetic glucose tolerance. Oral absorption is rapid, absorption rate> 37%. It was metabolized to benazepril in liver after oral administration. Its T1/2 is about 4H. Protein binding rate was 95%. |
| Use | This product is used for hypertension, congestive heart failure |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| UN IDs | 3077 |
| WGK Germany | 2 |
| RTECS | CX7065000 |
| HS Code | 29337900 |